C19H16F5NO3 — CID 27052807
(E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-[[4-(trifluoromethyl)phenyl]methyl]prop-2-enamide (PubChem CID 27052807) has the molecular formula C19H16F5NO3 and a molecular weight of 401.33 g/mol. Its IUPAC name is (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-[[4-(trifluoromethyl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-[[4-(trifluoromethyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 27052807 |
| Molecular Formula | C19H16F5NO3 |
| Molecular Weight | 401.33 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-[[4-(trifluoromethyl)phenyl]methyl]prop-2-enamide |
| SMILES | COc1cccc(/C=C/C(=O)NCc2ccc(C(F)(F)F)cc2)c1OC(F)F |
| InChI | InChI=1S/C19H16F5NO3/c1-27-15-4-2-3-13(17(15)28-18(20)21)7-10-16(26)25-11-12-5-8-14(9-6-12)19(22,23)24/h2-10,18H,11H2,1H3,(H,25,26)/b10-7+ |
| InChIKey | WAABNTDSKLBYNT-JXMROGBWSA-N |
| XLogP | 4.64 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.33 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|