C19H17F3N2O3 — CID 108933916
(E)-3-(2-methoxyphenyl)-N-[[4-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]prop-2-enamide (PubChem CID 108933916) has the molecular formula C19H17F3N2O3 and a molecular weight of 378.35 g/mol. Its IUPAC name is (E)-3-(2-methoxyphenyl)-N-[[4-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(2-methoxyphenyl)-N-[[4-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 108933916 |
| Molecular Formula | C19H17F3N2O3 |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | (E)-3-(2-methoxyphenyl)-N-[[4-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]prop-2-enamide |
| SMILES | COc1ccccc1/C=C/C(=O)NCc1ccc(NC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H17F3N2O3/c1-27-16-5-3-2-4-14(16)8-11-17(25)23-12-13-6-9-15(10-7-13)24-18(26)19(20,21)22/h2-11H,12H2,1H3,(H,23,25)(H,24,26)/b11-8+ |
| InChIKey | FYWZWTUYHPIEPL-DHZHZOJOSA-N |
| XLogP | 3.53 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|