C14H15F3N2O2 — CID 108933948
3-methyl-N-[[4-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]but-2-enamide (PubChem CID 108933948) has the molecular formula C14H15F3N2O2 and a molecular weight of 300.28 g/mol. Its IUPAC name is 3-methyl-N-[[4-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]but-2-enamide.
| Compound Name | 3-methyl-N-[[4-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]but-2-enamide |
|---|---|
| PubChem CID | 108933948 |
| Molecular Formula | C14H15F3N2O2 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 3-methyl-N-[[4-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]but-2-enamide |
| SMILES | CC(C)=CC(=O)NCc1ccc(NC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H15F3N2O2/c1-9(2)7-12(20)18-8-10-3-5-11(6-4-10)19-13(21)14(15,16)17/h3-7H,8H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | WRFLJDYFFDKBIO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|