C20H16F3N3O2 — CID 108933756
4-pyrrol-1-yl-N-[[4-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]benzamide (PubChem CID 108933756) has the molecular formula C20H16F3N3O2 and a molecular weight of 387.36 g/mol. Its IUPAC name is 4-pyrrol-1-yl-N-[[4-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]benzamide.
| Compound Name | 4-pyrrol-1-yl-N-[[4-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 108933756 |
| Molecular Formula | C20H16F3N3O2 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 4-pyrrol-1-yl-N-[[4-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(NC(=O)C(F)(F)F)cc1)c1ccc(-n2cccc2)cc1 |
| InChI | InChI=1S/C20H16F3N3O2/c21-20(22,23)19(28)25-16-7-3-14(4-8-16)13-24-18(27)15-5-9-17(10-6-15)26-11-1-2-12-26/h1-12H,13H2,(H,24,27)(H,25,28) |
| InChIKey | ZRDPZSOAMVAXNT-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |