C18H16F3N3O3 — CID 108933635
N-[2-oxo-2-[4-[[(2,2,2-trifluoroacetyl)amino]methyl]anilino]ethyl]benzamide (PubChem CID 108933635) has the molecular formula C18H16F3N3O3 and a molecular weight of 379.34 g/mol. Its IUPAC name is N-[2-oxo-2-[4-[[(2,2,2-trifluoroacetyl)amino]methyl]anilino]ethyl]benzamide.
| Compound Name | N-[2-oxo-2-[4-[[(2,2,2-trifluoroacetyl)amino]methyl]anilino]ethyl]benzamide |
|---|---|
| PubChem CID | 108933635 |
| Molecular Formula | C18H16F3N3O3 |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | N-[2-oxo-2-[4-[[(2,2,2-trifluoroacetyl)amino]methyl]anilino]ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1)Nc1ccc(CNC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H16F3N3O3/c19-18(20,21)17(27)23-10-12-6-8-14(9-7-12)24-15(25)11-22-16(26)13-4-2-1-3-5-13/h1-9H,10-11H2,(H,22,26)(H,23,27)(H,24,25) |
| InChIKey | WEPWGTYOKKVFSD-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |