C17H13F3N2O3 — CID 166070237
N-[2-(2-benzoylanilino)-2-oxoethyl]-2,2,2-trifluoroacetamide (PubChem CID 166070237) has the molecular formula C17H13F3N2O3 and a molecular weight of 350.30 g/mol. Its IUPAC name is N-[2-(2-benzoylanilino)-2-oxoethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-(2-benzoylanilino)-2-oxoethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 166070237 |
| Molecular Formula | C17H13F3N2O3 |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | N-[2-(2-benzoylanilino)-2-oxoethyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(CNC(=O)C(F)(F)F)Nc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C17H13F3N2O3/c18-17(19,20)16(25)21-10-14(23)22-13-9-5-4-8-12(13)15(24)11-6-2-1-3-7-11/h1-9H,10H2,(H,21,25)(H,22,23) |
| InChIKey | YTYARUGMXLFWFL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |