C16H12F3NO2 — CID 4702291
N-(2-benzoyl-4-methylphenyl)-2,2,2-trifluoroacetamide (PubChem CID 4702291) has the molecular formula C16H12F3NO2 and a molecular weight of 307.27 g/mol. Its IUPAC name is N-(2-benzoyl-4-methylphenyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(2-benzoyl-4-methylphenyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 4702291 |
| Molecular Formula | C16H12F3NO2 |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | N-(2-benzoyl-4-methylphenyl)-2,2,2-trifluoroacetamide |
| SMILES | Cc1ccc(NC(=O)C(F)(F)F)c(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C16H12F3NO2/c1-10-7-8-13(20-15(22)16(17,18)19)12(9-10)14(21)11-5-3-2-4-6-11/h2-9H,1H3,(H,20,22) |
| InChIKey | XCGGKTQSQMLFII-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |