C21H17F3NO2P — CID 102411791
N-(2-diphenylphosphoryl-4-methylphenyl)-2,2,2-trifluoroacetamide (PubChem CID 102411791) has the molecular formula C21H17F3NO2P and a molecular weight of 403.34 g/mol. Its IUPAC name is N-(2-diphenylphosphoryl-4-methylphenyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(2-diphenylphosphoryl-4-methylphenyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 102411791 |
| Molecular Formula | C21H17F3NO2P |
| Molecular Weight | 403.34 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | N-(2-diphenylphosphoryl-4-methylphenyl)-2,2,2-trifluoroacetamide |
| SMILES | Cc1ccc(NC(=O)C(F)(F)F)c(P(=O)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C21H17F3NO2P/c1-15-12-13-18(25-20(26)21(22,23)24)19(14-15)28(27,16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-14H,1H3,(H,25,26) |
| InChIKey | VRNJUKOVBJHDPW-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.34 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|