C34H32O2P2 — CID 139462616
1,2-bis[bis(4-methylphenyl)phosphoryl]benzene (PubChem CID 139462616) has the molecular formula C34H32O2P2 and a molecular weight of 534.58 g/mol. Its IUPAC name is 1,2-bis[bis(4-methylphenyl)phosphoryl]benzene.
| Compound Name | 1,2-bis[bis(4-methylphenyl)phosphoryl]benzene |
|---|---|
| PubChem CID | 139462616 |
| Molecular Formula | C34H32O2P2 |
| Molecular Weight | 534.58 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | 1,2-bis[bis(4-methylphenyl)phosphoryl]benzene |
| SMILES | Cc1ccc(P(=O)(c2ccc(C)cc2)c2ccccc2P(=O)(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C34H32O2P2/c1-25-9-17-29(18-10-25)37(35,30-19-11-26(2)12-20-30)33-7-5-6-8-34(33)38(36,31-21-13-27(3)14-22-31)32-23-15-28(4)16-24-32/h5-24H,1-4H3 |
| InChIKey | KJFDUPHKCITCGT-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.58 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|