C43H43O5P3 — CID 15910881
1-bis(4-methylphenyl)phosphoryl-2-[[[2-bis(4-methylphenyl)phosphorylphenoxy]methyl-methylphosphoryl]methoxy]benzene (PubChem CID 15910881) has the molecular formula C43H43O5P3 and a molecular weight of 732.73 g/mol. Its IUPAC name is 1-bis(4-methylphenyl)phosphoryl-2-[[[2-bis(4-methylphenyl)phosphorylphenoxy]methyl-methylphosphoryl]methoxy]benzene.
| Compound Name | 1-bis(4-methylphenyl)phosphoryl-2-[[[2-bis(4-methylphenyl)phosphorylphenoxy]methyl-methylphosphoryl]methoxy]benzene |
|---|---|
| PubChem CID | 15910881 |
| Molecular Formula | C43H43O5P3 |
| Molecular Weight | 732.73 g/mol |
| Exact Mass | 732.23 |
| IUPAC Name | 1-bis(4-methylphenyl)phosphoryl-2-[[[2-bis(4-methylphenyl)phosphorylphenoxy]methyl-methylphosphoryl]methoxy]benzene |
| SMILES | Cc1ccc(P(=O)(c2ccc(C)cc2)c2ccccc2OCP(C)(=O)COc2ccccc2P(=O)(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C43H43O5P3/c1-32-14-22-36(23-15-32)50(45,37-24-16-33(2)17-25-37)42-12-8-6-10-40(42)47-30-49(5,44)31-48-41-11-7-9-13-43(41)51(46,38-26-18-34(3)19-27-38)39-28-20-35(4)21-29-39/h6-29H,30-31H2,1-5H3 |
| InChIKey | RCOWWTIFXOGSKC-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.73 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|