C32H27O3P — CID 20750497
1-diphenylphosphoryl-2,4-bis(4-methylphenoxy)benzene (PubChem CID 20750497) has the molecular formula C32H27O3P and a molecular weight of 490.54 g/mol. Its IUPAC name is 1-diphenylphosphoryl-2,4-bis(4-methylphenoxy)benzene.
| Compound Name | 1-diphenylphosphoryl-2,4-bis(4-methylphenoxy)benzene |
|---|---|
| PubChem CID | 20750497 |
| Molecular Formula | C32H27O3P |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 1-diphenylphosphoryl-2,4-bis(4-methylphenoxy)benzene |
| SMILES | Cc1ccc(Oc2ccc(P(=O)(c3ccccc3)c3ccccc3)c(Oc3ccc(C)cc3)c2)cc1 |
| InChI | InChI=1S/C32H27O3P/c1-24-13-17-26(18-14-24)34-28-21-22-32(31(23-28)35-27-19-15-25(2)16-20-27)36(33,29-9-5-3-6-10-29)30-11-7-4-8-12-30/h3-23H,1-2H3 |
| InChIKey | VTLLQBXYWAGBML-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|