About chlorophosphonic acid;1-methyl-4-phenoxybenzene
chlorophosphonic acid;1-methyl-4-phenoxybenzene (PubChem CID 88791217) has the molecular formula C13H14ClO4P
and a molecular weight of 300.68 g/mol. Its IUPAC name is chlorophosphonic acid;1-methyl-4-phenoxybenzene.
Molecular Properties
| Compound Name | chlorophosphonic acid;1-methyl-4-phenoxybenzene |
| PubChem CID | 88791217 |
| Molecular Formula | C13H14ClO4P |
| Molecular Weight | 300.68 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | chlorophosphonic acid;1-methyl-4-phenoxybenzene |
| SMILES | Cc1ccc(Oc2ccccc2)cc1.O=P(O)(O)Cl |
| InChI | InChI=1S/C13H12O.ClH2O3P/c1-11-7-9-13(10-8-11)14-12-5-3-2-4-6-12;1-5(2,3)4/h2-10H,1H3;(H2,2,3,4) |
| InChIKey | RXSCIWVHBFCYEN-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.68 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chlorophosphonic acid;1-methyl-4-phenoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorophosphonic acid;1-methyl-4-phenoxybenzene?
The IUPAC name of chlorophosphonic acid;1-methyl-4-phenoxybenzene (CID 88791217) is chlorophosphonic acid;1-methyl-4-phenoxybenzene.
What is the SMILES notation for chlorophosphonic acid;1-methyl-4-phenoxybenzene?
The canonical SMILES for chlorophosphonic acid;1-methyl-4-phenoxybenzene is Cc1ccc(Oc2ccccc2)cc1.O=P(O)(O)Cl.
What is the InChIKey of chlorophosphonic acid;1-methyl-4-phenoxybenzene?
The InChIKey is RXSCIWVHBFCYEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O.ClH2O3P/c1-11-7-9-13(10-8-11)14-12-5-3-2-4-6-12;1-5(2,3)4/h2-10H,1H3;(H2,2,3,4).
What are the key properties of chlorophosphonic acid;1-methyl-4-phenoxybenzene?
chlorophosphonic acid;1-methyl-4-phenoxybenzene has a molecular weight of 300.68 g/mol, XLogP of 4.11, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chlorophosphonic acid;1-methyl-4-phenoxybenzene is sourced from PubChem (CID 88791217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).