C28H28O2 — CID 144542678
1,4-bis(4-methylphenoxy)-2-phenylbenzene;ethane (PubChem CID 144542678) has the molecular formula C28H28O2 and a molecular weight of 396.53 g/mol. Its IUPAC name is 1,4-bis(4-methylphenoxy)-2-phenylbenzene;ethane.
| Compound Name | 1,4-bis(4-methylphenoxy)-2-phenylbenzene;ethane |
|---|---|
| PubChem CID | 144542678 |
| Molecular Formula | C28H28O2 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 1,4-bis(4-methylphenoxy)-2-phenylbenzene;ethane |
| SMILES | CC.Cc1ccc(Oc2ccc(Oc3ccc(C)cc3)c(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C26H22O2.C2H6/c1-19-8-12-22(13-9-19)27-24-16-17-26(28-23-14-10-20(2)11-15-23)25(18-24)21-6-4-3-5-7-21;1-2/h3-18H,1-2H3;1-2H3 |
| InChIKey | ZETGCQKRSLQDHF-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |