C60H46O5P4 — CID 132556763
1-[2,4-bis(diphenylphosphoryl)phenoxy]-2,4-bis(diphenylphosphoryl)benzene (PubChem CID 132556763) has the molecular formula C60H46O5P4 and a molecular weight of 970.92 g/mol. Its IUPAC name is 1-[2,4-bis(diphenylphosphoryl)phenoxy]-2,4-bis(diphenylphosphoryl)benzene.
| Compound Name | 1-[2,4-bis(diphenylphosphoryl)phenoxy]-2,4-bis(diphenylphosphoryl)benzene |
|---|---|
| PubChem CID | 132556763 |
| Molecular Formula | C60H46O5P4 |
| Molecular Weight | 970.92 g/mol |
| Exact Mass | 970.23 |
| IUPAC Name | 1-[2,4-bis(diphenylphosphoryl)phenoxy]-2,4-bis(diphenylphosphoryl)benzene |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1ccc(Oc2ccc(P(=O)(c3ccccc3)c3ccccc3)cc2P(=O)(c2ccccc2)c2ccccc2)c(P(=O)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C60H46O5P4/c61-66(47-25-9-1-10-26-47,48-27-11-2-12-28-48)55-41-43-57(59(45-55)68(63,51-33-17-5-18-34-51)52-35-19-6-20-36-52)65-58-44-42-56(67(62,49-29-13-3-14-30-49)50-31-15-4-16-32-50)46-60(58)69(64,53-37-21-7-22-38-53)54-39-23-8-24-40-54/h1-46H |
| InChIKey | DOCHDRDLUUMFQG-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 970.92 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|