C36H28O3P2 — CID 166047124
1,2,3,4-tetradeuterio-5-diphenylphosphoryl-6-(2,3,4,5-tetradeuterio-6-diphenylphosphorylphenoxy)benzene (PubChem CID 166047124) has the molecular formula C36H28O3P2 and a molecular weight of 578.61 g/mol. Its IUPAC name is 1,2,3,4-tetradeuterio-5-diphenylphosphoryl-6-(2,3,4,5-tetradeuterio-6-diphenylphosphorylphenoxy)benzene.
| Compound Name | 1,2,3,4-tetradeuterio-5-diphenylphosphoryl-6-(2,3,4,5-tetradeuterio-6-diphenylphosphorylphenoxy)benzene |
|---|---|
| PubChem CID | 166047124 |
| Molecular Formula | C36H28O3P2 |
| Molecular Weight | 578.61 g/mol |
| Exact Mass | 578.20 |
| IUPAC Name | 1,2,3,4-tetradeuterio-5-diphenylphosphoryl-6-(2,3,4,5-tetradeuterio-6-diphenylphosphorylphenoxy)benzene |
| SMILES | [2H]c1c([2H])c([2H])c(P(=O)(c2ccccc2)c2ccccc2)c(Oc2c([2H])c([2H])c([2H])c([2H])c2P(=O)(c2ccccc2)c2ccccc2)c1[2H] |
| InChI | InChI=1S/C36H28O3P2/c37-40(29-17-5-1-6-18-29,30-19-7-2-8-20-30)35-27-15-13-25-33(35)39-34-26-14-16-28-36(34)41(38,31-21-9-3-10-22-31)32-23-11-4-12-24-32/h1-28H/i13D,14D,15D,16D,25D,26D,27D,28D |
| InChIKey | ATTVYRDSOVWELU-BJKITNDTSA-N |
| XLogP | 6.76 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.61 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|