About diiodocobalt;bis(diphenylphosphorylbenzene)
diiodocobalt;bis(diphenylphosphorylbenzene) (PubChem CID 154702808) has the molecular formula C36H30CoI2O2P2
and a molecular weight of 869.32 g/mol. Its IUPAC name is diiodocobalt;bis(diphenylphosphorylbenzene).
Molecular Properties
| Compound Name | diiodocobalt;bis(diphenylphosphorylbenzene) |
| PubChem CID | 154702808 |
| Molecular Formula | C36H30CoI2O2P2 |
| Molecular Weight | 869.32 g/mol |
| Exact Mass | 868.91 |
| IUPAC Name | diiodocobalt;bis(diphenylphosphorylbenzene) |
| SMILES | I[Co]I.O=P(c1ccccc1)(c1ccccc1)c1ccccc1.O=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/2C18H15OP.Co.2HI/c2*19-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;/h2*1-15H;;2*1H/q;;+2;;/p-2 |
| InChIKey | UWHWQZLLLNUWKA-UHFFFAOYSA-L |
| XLogP | 8.42 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 869.32 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diiodocobalt;bis(diphenylphosphorylbenzene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diiodocobalt;bis(diphenylphosphorylbenzene)?
The IUPAC name of diiodocobalt;bis(diphenylphosphorylbenzene) (CID 154702808) is diiodocobalt;bis(diphenylphosphorylbenzene).
What is the SMILES notation for diiodocobalt;bis(diphenylphosphorylbenzene)?
The canonical SMILES for diiodocobalt;bis(diphenylphosphorylbenzene) is I[Co]I.O=P(c1ccccc1)(c1ccccc1)c1ccccc1.O=P(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of diiodocobalt;bis(diphenylphosphorylbenzene)?
The InChIKey is UWHWQZLLLNUWKA-UHFFFAOYSA-L. The full InChI is InChI=1S/2C18H15OP.Co.2HI/c2*19-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;/h2*1-15H;;2*1H/q;;+2;;/p-2.
What are the key properties of diiodocobalt;bis(diphenylphosphorylbenzene)?
diiodocobalt;bis(diphenylphosphorylbenzene) has a molecular weight of 869.32 g/mol, XLogP of 8.42, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diiodocobalt;bis(diphenylphosphorylbenzene) is sourced from PubChem (CID 154702808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).