C61H48O4P4 — CID 58298983
1-[[3,5-bis(diphenylphosphoryl)phenyl]methyl]-3,5-bis(diphenylphosphoryl)benzene (PubChem CID 58298983) has the molecular formula C61H48O4P4 and a molecular weight of 968.95 g/mol. Its IUPAC name is 1-[[3,5-bis(diphenylphosphoryl)phenyl]methyl]-3,5-bis(diphenylphosphoryl)benzene.
| Compound Name | 1-[[3,5-bis(diphenylphosphoryl)phenyl]methyl]-3,5-bis(diphenylphosphoryl)benzene |
|---|---|
| PubChem CID | 58298983 |
| Molecular Formula | C61H48O4P4 |
| Molecular Weight | 968.95 g/mol |
| Exact Mass | 968.25 |
| IUPAC Name | 1-[[3,5-bis(diphenylphosphoryl)phenyl]methyl]-3,5-bis(diphenylphosphoryl)benzene |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1cc(Cc2cc(P(=O)(c3ccccc3)c3ccccc3)cc(P(=O)(c3ccccc3)c3ccccc3)c2)cc(P(=O)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C61H48O4P4/c62-66(50-25-9-1-10-26-50,51-27-11-2-12-28-51)58-42-48(43-59(46-58)67(63,52-29-13-3-14-30-52)53-31-15-4-16-32-53)41-49-44-60(68(64,54-33-17-5-18-34-54)55-35-19-6-20-36-55)47-61(45-49)69(65,56-37-21-7-22-38-56)57-39-23-8-24-40-57/h1-40,42-47H,41H2 |
| InChIKey | INWXXZBLFWCJBH-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 968.95 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|