About diphenylphosphorylbenzene;oxirene
diphenylphosphorylbenzene;oxirene (PubChem CID 174881764) has the molecular formula C20H17O2P
and a molecular weight of 320.33 g/mol. Its IUPAC name is diphenylphosphorylbenzene;oxirene.
Molecular Properties
| Compound Name | diphenylphosphorylbenzene;oxirene |
| PubChem CID | 174881764 |
| Molecular Formula | C20H17O2P |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | diphenylphosphorylbenzene;oxirene |
| SMILES | C1=CO1.O=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H15OP.C2H2O/c19-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-3-1/h1-15H;1-2H |
| InChIKey | GUEGFINDPNUYGS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenylphosphorylbenzene;oxirene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylphosphorylbenzene;oxirene?
The IUPAC name of diphenylphosphorylbenzene;oxirene (CID 174881764) is diphenylphosphorylbenzene;oxirene.
What is the SMILES notation for diphenylphosphorylbenzene;oxirene?
The canonical SMILES for diphenylphosphorylbenzene;oxirene is C1=CO1.O=P(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylphosphorylbenzene;oxirene?
The InChIKey is GUEGFINDPNUYGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15OP.C2H2O/c19-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-3-1/h1-15H;1-2H.
What are the key properties of diphenylphosphorylbenzene;oxirene?
diphenylphosphorylbenzene;oxirene has a molecular weight of 320.33 g/mol, XLogP of 3.81, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylphosphorylbenzene;oxirene is sourced from PubChem (CID 174881764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).