C20H19O3P — CID 15129135
2-diphenylphosphoryl-1,4-dimethoxybenzene (PubChem CID 15129135) has the molecular formula C20H19O3P and a molecular weight of 338.34 g/mol. Its IUPAC name is 2-diphenylphosphoryl-1,4-dimethoxybenzene.
| Compound Name | 2-diphenylphosphoryl-1,4-dimethoxybenzene |
|---|---|
| PubChem CID | 15129135 |
| Molecular Formula | C20H19O3P |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 2-diphenylphosphoryl-1,4-dimethoxybenzene |
| SMILES | COc1ccc(OC)c(P(=O)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C20H19O3P/c1-22-16-13-14-19(23-2)20(15-16)24(21,17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-15H,1-2H3 |
| InChIKey | FMALRWFJSNSCMR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|