C32H26F3N2O3P — CID 20750532
4-[4-[4-amino-2-(trifluoromethyl)phenoxy]-2-diphenylphosphorylphenoxy]-3-methylaniline (PubChem CID 20750532) has the molecular formula C32H26F3N2O3P and a molecular weight of 574.54 g/mol. Its IUPAC name is 4-[4-[4-amino-2-(trifluoromethyl)phenoxy]-2-diphenylphosphorylphenoxy]-3-methylaniline.
| Compound Name | 4-[4-[4-amino-2-(trifluoromethyl)phenoxy]-2-diphenylphosphorylphenoxy]-3-methylaniline |
|---|---|
| PubChem CID | 20750532 |
| Molecular Formula | C32H26F3N2O3P |
| Molecular Weight | 574.54 g/mol |
| Exact Mass | 574.16 |
| IUPAC Name | 4-[4-[4-amino-2-(trifluoromethyl)phenoxy]-2-diphenylphosphorylphenoxy]-3-methylaniline |
| SMILES | Cc1cc(N)ccc1Oc1ccc(Oc2ccc(N)cc2C(F)(F)F)cc1P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H26F3N2O3P/c1-21-18-22(36)12-15-28(21)40-30-17-14-24(39-29-16-13-23(37)19-27(29)32(33,34)35)20-31(30)41(38,25-8-4-2-5-9-25)26-10-6-3-7-11-26/h2-20H,36-37H2,1H3 |
| InChIKey | JEOTWJITNHBCOS-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.54 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|