C23H20F6N2O2 — CID 141306794
4-[4-[4-amino-2-(trifluoromethyl)phenoxy]-2,3,5-trimethylphenoxy]-3-(trifluoromethyl)aniline (PubChem CID 141306794) has the molecular formula C23H20F6N2O2 and a molecular weight of 470.41 g/mol. Its IUPAC name is 4-[4-[4-amino-2-(trifluoromethyl)phenoxy]-2,3,5-trimethylphenoxy]-3-(trifluoromethyl)aniline.
| Compound Name | 4-[4-[4-amino-2-(trifluoromethyl)phenoxy]-2,3,5-trimethylphenoxy]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 141306794 |
| Molecular Formula | C23H20F6N2O2 |
| Molecular Weight | 470.41 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 4-[4-[4-amino-2-(trifluoromethyl)phenoxy]-2,3,5-trimethylphenoxy]-3-(trifluoromethyl)aniline |
| SMILES | Cc1cc(Oc2ccc(N)cc2C(F)(F)F)c(C)c(C)c1Oc1ccc(N)cc1C(F)(F)F |
| InChI | InChI=1S/C23H20F6N2O2/c1-11-8-20(32-18-6-4-14(30)9-16(18)22(24,25)26)12(2)13(3)21(11)33-19-7-5-15(31)10-17(19)23(27,28)29/h4-10H,30-31H2,1-3H3 |
| InChIKey | ZQSNLJZTKCERIT-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.41 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|