C28H18F6N2O — CID 176916153
4-[10-[4-amino-2-(trifluoromethyl)phenoxy]anthracen-9-yl]-3-(trifluoromethyl)aniline (PubChem CID 176916153) has the molecular formula C28H18F6N2O and a molecular weight of 512.45 g/mol. Its IUPAC name is 4-[10-[4-amino-2-(trifluoromethyl)phenoxy]anthracen-9-yl]-3-(trifluoromethyl)aniline.
| Compound Name | 4-[10-[4-amino-2-(trifluoromethyl)phenoxy]anthracen-9-yl]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 176916153 |
| Molecular Formula | C28H18F6N2O |
| Molecular Weight | 512.45 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | 4-[10-[4-amino-2-(trifluoromethyl)phenoxy]anthracen-9-yl]-3-(trifluoromethyl)aniline |
| SMILES | Nc1ccc(Oc2c3ccccc3c(-c3ccc(N)cc3C(F)(F)F)c3ccccc23)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H18F6N2O/c29-27(30,31)22-13-15(35)9-11-21(22)25-17-5-1-3-7-19(17)26(20-8-4-2-6-18(20)25)37-24-12-10-16(36)14-23(24)28(32,33)34/h1-14H,35-36H2 |
| InChIKey | ODGYZLYMFVPKLV-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.45 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|