C13H9F3INO — CID 55191480
4-(2-iodophenoxy)-3-(trifluoromethyl)aniline (PubChem CID 55191480) has the molecular formula C13H9F3INO and a molecular weight of 379.12 g/mol. Its IUPAC name is 4-(2-iodophenoxy)-3-(trifluoromethyl)aniline.
| Compound Name | 4-(2-iodophenoxy)-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 55191480 |
| Molecular Formula | C13H9F3INO |
| Molecular Weight | 379.12 g/mol |
| Exact Mass | 378.97 |
| IUPAC Name | 4-(2-iodophenoxy)-3-(trifluoromethyl)aniline |
| SMILES | Nc1ccc(Oc2ccccc2I)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H9F3INO/c14-13(15,16)9-7-8(18)5-6-11(9)19-12-4-2-1-3-10(12)17/h1-7H,18H2 |
| InChIKey | NKNQCARJZIWKNL-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.12 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|