C24H22F6N2O2 — CID 102252770
4-[2-[4-amino-2-(trifluoromethyl)phenoxy]-4-tert-butylphenoxy]-3-(trifluoromethyl)aniline (PubChem CID 102252770) has the molecular formula C24H22F6N2O2 and a molecular weight of 484.44 g/mol. Its IUPAC name is 4-[2-[4-amino-2-(trifluoromethyl)phenoxy]-4-tert-butylphenoxy]-3-(trifluoromethyl)aniline.
| Compound Name | 4-[2-[4-amino-2-(trifluoromethyl)phenoxy]-4-tert-butylphenoxy]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 102252770 |
| Molecular Formula | C24H22F6N2O2 |
| Molecular Weight | 484.44 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | 4-[2-[4-amino-2-(trifluoromethyl)phenoxy]-4-tert-butylphenoxy]-3-(trifluoromethyl)aniline |
| SMILES | CC(C)(C)c1ccc(Oc2ccc(N)cc2C(F)(F)F)c(Oc2ccc(N)cc2C(F)(F)F)c1 |
| InChI | InChI=1S/C24H22F6N2O2/c1-22(2,3)13-4-7-20(33-18-8-5-14(31)11-16(18)23(25,26)27)21(10-13)34-19-9-6-15(32)12-17(19)24(28,29)30/h4-12H,31-32H2,1-3H3 |
| InChIKey | WVZWJTFOSMSTAO-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.44 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|