C13H20F3NOSi — CID 167742653
4-[tert-butyl(dimethyl)silyl]oxy-3-(trifluoromethyl)aniline (PubChem CID 167742653) has the molecular formula C13H20F3NOSi and a molecular weight of 291.39 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-3-(trifluoromethyl)aniline.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 167742653 |
| Molecular Formula | C13H20F3NOSi |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-3-(trifluoromethyl)aniline |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(N)cc1C(F)(F)F |
| InChI | InChI=1S/C13H20F3NOSi/c1-12(2,3)19(4,5)18-11-7-6-9(17)8-10(11)13(14,15)16/h6-8H,17H2,1-5H3 |
| InChIKey | IIVGTSYMNAAKOU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|