C14H19F6NOSi — CID 169435458
4-[tert-butyl(dimethyl)silyl]oxy-2,5-bis(trifluoromethyl)aniline (PubChem CID 169435458) has the molecular formula C14H19F6NOSi and a molecular weight of 359.39 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-2,5-bis(trifluoromethyl)aniline.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-2,5-bis(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 169435458 |
| Molecular Formula | C14H19F6NOSi |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-2,5-bis(trifluoromethyl)aniline |
| SMILES | CC(C)(C)[Si](C)(C)Oc1cc(C(F)(F)F)c(N)cc1C(F)(F)F |
| InChI | InChI=1S/C14H19F6NOSi/c1-12(2,3)23(4,5)22-11-7-8(13(15,16)17)10(21)6-9(11)14(18,19)20/h6-7H,21H2,1-5H3 |
| InChIKey | BLFYYFIPYJOSOM-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|