C16H18F6N4 — CID 162540560
2,5-bis(trifluoromethyl)benzene-1,4-diamine;2,5-dimethylbenzene-1,4-diamine (PubChem CID 162540560) has the molecular formula C16H18F6N4 and a molecular weight of 380.34 g/mol. Its IUPAC name is 2,5-bis(trifluoromethyl)benzene-1,4-diamine;2,5-dimethylbenzene-1,4-diamine.
| Compound Name | 2,5-bis(trifluoromethyl)benzene-1,4-diamine;2,5-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 162540560 |
| Molecular Formula | C16H18F6N4 |
| Molecular Weight | 380.34 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 2,5-bis(trifluoromethyl)benzene-1,4-diamine;2,5-dimethylbenzene-1,4-diamine |
| SMILES | Cc1cc(N)c(C)cc1N.Nc1cc(C(F)(F)F)c(N)cc1C(F)(F)F |
| InChI | InChI=1S/C8H6F6N2.C8H12N2/c9-7(10,11)3-1-5(15)4(2-6(3)16)8(12,13)14;1-5-3-8(10)6(2)4-7(5)9/h1-2H,15-16H2;3-4H,9-10H2,1-2H3 |
| InChIKey | LFMUNZXKPPDWKG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.34 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|