C14H21NO5Si — CID 167716868
4-amino-6-[tert-butyl(dimethyl)silyl]oxybenzene-1,3-dicarboxylic acid (PubChem CID 167716868) has the molecular formula C14H21NO5Si and a molecular weight of 311.41 g/mol. Its IUPAC name is 4-amino-6-[tert-butyl(dimethyl)silyl]oxybenzene-1,3-dicarboxylic acid.
| Compound Name | 4-amino-6-[tert-butyl(dimethyl)silyl]oxybenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 167716868 |
| Molecular Formula | C14H21NO5Si |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 4-amino-6-[tert-butyl(dimethyl)silyl]oxybenzene-1,3-dicarboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)Oc1cc(N)c(C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C14H21NO5Si/c1-14(2,3)21(4,5)20-11-7-10(15)8(12(16)17)6-9(11)13(18)19/h6-7H,15H2,1-5H3,(H,16,17)(H,18,19) |
| InChIKey | MERLUFNXPKIEDK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|