C9H11NO4 — CID 59662843
2-amino-4,5-bis(trideuteriomethoxy)benzoic acid (PubChem CID 59662843) has the molecular formula C9H11NO4 and a molecular weight of 203.23 g/mol. Its IUPAC name is 2-amino-4,5-bis(trideuteriomethoxy)benzoic acid.
| Compound Name | 2-amino-4,5-bis(trideuteriomethoxy)benzoic acid |
|---|---|
| PubChem CID | 59662843 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 203.23 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 2-amino-4,5-bis(trideuteriomethoxy)benzoic acid |
| SMILES | [2H]C([2H])([2H])Oc1cc(N)c(C(=O)O)cc1OC([2H])([2H])[2H] |
| InChI | InChI=1S/C9H11NO4/c1-13-7-3-5(9(11)12)6(10)4-8(7)14-2/h3-4H,10H2,1-2H3,(H,11,12)/i1D3,2D3 |
| InChIKey | HJVAVGOPTDJYOJ-WFGJKAKNSA-N |
| XLogP | 0.98 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.23 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|