C10H10F3NO4 — CID 43380092
2-amino-4-methoxy-5-(2,2,2-trifluoroethoxy)benzoic acid (PubChem CID 43380092) has the molecular formula C10H10F3NO4 and a molecular weight of 265.19 g/mol. Its IUPAC name is 2-amino-4-methoxy-5-(2,2,2-trifluoroethoxy)benzoic acid.
| Compound Name | 2-amino-4-methoxy-5-(2,2,2-trifluoroethoxy)benzoic acid |
|---|---|
| PubChem CID | 43380092 |
| Molecular Formula | C10H10F3NO4 |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 2-amino-4-methoxy-5-(2,2,2-trifluoroethoxy)benzoic acid |
| SMILES | COc1cc(N)c(C(=O)O)cc1OCC(F)(F)F |
| InChI | InChI=1S/C10H10F3NO4/c1-17-7-3-6(14)5(9(15)16)2-8(7)18-4-10(11,12)13/h2-3H,4,14H2,1H3,(H,15,16) |
| InChIKey | CUCNNSNGOBALJH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|