C14H21NO4 — CID 62264681
2-amino-4-methoxy-5-(2-methylpentoxy)benzoic acid (PubChem CID 62264681) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is 2-amino-4-methoxy-5-(2-methylpentoxy)benzoic acid.
| Compound Name | 2-amino-4-methoxy-5-(2-methylpentoxy)benzoic acid |
|---|---|
| PubChem CID | 62264681 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 2-amino-4-methoxy-5-(2-methylpentoxy)benzoic acid |
| SMILES | CCCC(C)COc1cc(C(=O)O)c(N)cc1OC |
| InChI | InChI=1S/C14H21NO4/c1-4-5-9(2)8-19-13-6-10(14(16)17)11(15)7-12(13)18-3/h6-7,9H,4-5,8,15H2,1-3H3,(H,16,17) |
| InChIKey | AYADYRFNLBRFMR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|