C20H23N2O7U- — CID 163991939
2-amino-4-[5-(3-amino-4-carboxybenzene-6-id-1-yl)oxypentoxy]-5-methoxybenzoic acid;uranium (PubChem CID 163991939) has the molecular formula C20H23N2O7U- and a molecular weight of 641.44 g/mol. Its IUPAC name is 2-amino-4-[5-(3-amino-4-carboxybenzene-6-id-1-yl)oxypentoxy]-5-methoxybenzoic acid;uranium.
| Compound Name | 2-amino-4-[5-(3-amino-4-carboxybenzene-6-id-1-yl)oxypentoxy]-5-methoxybenzoic acid;uranium |
|---|---|
| PubChem CID | 163991939 |
| Molecular Formula | C20H23N2O7U- |
| Molecular Weight | 641.44 g/mol |
| Exact Mass | 641.20 |
| IUPAC Name | 2-amino-4-[5-(3-amino-4-carboxybenzene-6-id-1-yl)oxypentoxy]-5-methoxybenzoic acid;uranium |
| SMILES | COc1cc(C(=O)O)c(N)cc1OCCCCCOc1[c-]cc(C(=O)O)c(N)c1.[U] |
| InChI | InChI=1S/C20H23N2O7.U/c1-27-17-10-14(20(25)26)16(22)11-18(17)29-8-4-2-3-7-28-12-5-6-13(19(23)24)15(21)9-12;/h6,9-11H,2-4,7-8,21-22H2,1H3,(H,23,24)(H,25,26);/q-1; |
| InChIKey | INEYYHOOMPILAL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 154.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|