C26H33N3O7 — CID 131977348
2-amino-4-[5-[5-amino-2-methoxy-4-(3-methylidenepyrrolidine-1-carbonyl)phenoxy]pentoxy]-5-methoxybenzoic acid (PubChem CID 131977348) has the molecular formula C26H33N3O7 and a molecular weight of 499.56 g/mol. Its IUPAC name is 2-amino-4-[5-[5-amino-2-methoxy-4-(3-methylidenepyrrolidine-1-carbonyl)phenoxy]pentoxy]-5-methoxybenzoic acid.
| Compound Name | 2-amino-4-[5-[5-amino-2-methoxy-4-(3-methylidenepyrrolidine-1-carbonyl)phenoxy]pentoxy]-5-methoxybenzoic acid |
|---|---|
| PubChem CID | 131977348 |
| Molecular Formula | C26H33N3O7 |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | 2-amino-4-[5-[5-amino-2-methoxy-4-(3-methylidenepyrrolidine-1-carbonyl)phenoxy]pentoxy]-5-methoxybenzoic acid |
| SMILES | C=C1CCN(C(=O)c2cc(OC)c(OCCCCCOc3cc(N)c(C(=O)O)cc3OC)cc2N)C1 |
| InChI | InChI=1S/C26H33N3O7/c1-16-7-8-29(15-16)25(30)17-11-21(33-2)23(13-19(17)27)35-9-5-4-6-10-36-24-14-20(28)18(26(31)32)12-22(24)34-3/h11-14H,1,4-10,15,27-28H2,2-3H3,(H,31,32) |
| InChIKey | JJBDHDJRYKCGQE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 146.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|