C36H48N4O7 — CID 58473179
[(2S)-1-[2-amino-4-[5-[5-amino-4-[(2R)-2-ethyl-4-methylidenepyrrolidine-1-carbonyl]-2-methoxyphenoxy]pentoxy]-5-methylbenzoyl]-4-methylidenepyrrolidin-2-yl]methyl acetate (PubChem CID 58473179) has the molecular formula C36H48N4O7 and a molecular weight of 648.80 g/mol. Its IUPAC name is [(2S)-1-[2-amino-4-[5-[5-amino-4-[(2R)-2-ethyl-4-methylidenepyrrolidine-1-carbonyl]-2-methoxyphenoxy]pentoxy]-5-methylbenzoyl]-4-methylidenepyrrolidin-2-yl]methyl acetate.
| Compound Name | [(2S)-1-[2-amino-4-[5-[5-amino-4-[(2R)-2-ethyl-4-methylidenepyrrolidine-1-carbonyl]-2-methoxyphenoxy]pentoxy]-5-methylbenzoyl]-4-methylidenepyrrolidin-2-yl]methyl acetate |
|---|---|
| PubChem CID | 58473179 |
| Molecular Formula | C36H48N4O7 |
| Molecular Weight | 648.80 g/mol |
| Exact Mass | 648.35 |
| IUPAC Name | [(2S)-1-[2-amino-4-[5-[5-amino-4-[(2R)-2-ethyl-4-methylidenepyrrolidine-1-carbonyl]-2-methoxyphenoxy]pentoxy]-5-methylbenzoyl]-4-methylidenepyrrolidin-2-yl]methyl acetate |
| SMILES | C=C1C[C@@H](CC)N(C(=O)c2cc(OC)c(OCCCCCOc3cc(N)c(C(=O)N4CC(=C)C[C@H]4COC(C)=O)cc3C)cc2N)C1 |
| InChI | InChI=1S/C36H48N4O7/c1-7-26-13-22(2)19-39(26)36(43)29-16-33(44-6)34(18-31(29)38)46-12-10-8-9-11-45-32-17-30(37)28(15-24(32)4)35(42)40-20-23(3)14-27(40)21-47-25(5)41/h15-18,26-27H,2-3,7-14,19-21,37-38H2,1,4-6H3/t26-,27+/m1/s1 |
| InChIKey | XGOHCFSVPRAPJC-SXOMAYOGSA-N |
| XLogP | 5.31 |
| TPSA | 146.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.80 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|