C17H25NO5 — CID 145156530
6-[5-amino-2-methoxy-4-[(E)-1-methoxyprop-1-enyl]phenoxy]hexanoic acid (PubChem CID 145156530) has the molecular formula C17H25NO5 and a molecular weight of 323.39 g/mol. Its IUPAC name is 6-[5-amino-2-methoxy-4-[(E)-1-methoxyprop-1-enyl]phenoxy]hexanoic acid.
| Compound Name | 6-[5-amino-2-methoxy-4-[(E)-1-methoxyprop-1-enyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 145156530 |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 6-[5-amino-2-methoxy-4-[(E)-1-methoxyprop-1-enyl]phenoxy]hexanoic acid |
| SMILES | C/C=C(/OC)c1cc(OC)c(OCCCCCC(=O)O)cc1N |
| InChI | InChI=1S/C17H25NO5/c1-4-14(21-2)12-10-15(22-3)16(11-13(12)18)23-9-7-5-6-8-17(19)20/h4,10-11H,5-9,18H2,1-3H3,(H,19,20)/b14-4+ |
| InChIKey | WMJOKVVPECNMMX-LNKIKWGQSA-N |
| XLogP | 3.31 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|