C12H18ClNO5 — CID 159677080
4-(5-amino-2,3-dimethoxyphenoxy)butanoic acid;hydrochloride (PubChem CID 159677080) has the molecular formula C12H18ClNO5 and a molecular weight of 291.73 g/mol. Its IUPAC name is 4-(5-amino-2,3-dimethoxyphenoxy)butanoic acid;hydrochloride.
| Compound Name | 4-(5-amino-2,3-dimethoxyphenoxy)butanoic acid;hydrochloride |
|---|---|
| PubChem CID | 159677080 |
| Molecular Formula | C12H18ClNO5 |
| Molecular Weight | 291.73 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 4-(5-amino-2,3-dimethoxyphenoxy)butanoic acid;hydrochloride |
| SMILES | COc1cc(N)cc(OCCCC(=O)O)c1OC.Cl |
| InChI | InChI=1S/C12H17NO5.ClH/c1-16-9-6-8(13)7-10(12(9)17-2)18-5-3-4-11(14)15;/h6-7H,3-5,13H2,1-2H3,(H,14,15);1H |
| InChIKey | WVABDWWGEFOWRI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.73 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|