C11H18N2O5S — CID 20545463
4-(4,5-diamino-2-methoxyphenoxy)butane-1-sulfonic acid (PubChem CID 20545463) has the molecular formula C11H18N2O5S and a molecular weight of 290.34 g/mol. Its IUPAC name is 4-(4,5-diamino-2-methoxyphenoxy)butane-1-sulfonic acid.
| Compound Name | 4-(4,5-diamino-2-methoxyphenoxy)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 20545463 |
| Molecular Formula | C11H18N2O5S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 4-(4,5-diamino-2-methoxyphenoxy)butane-1-sulfonic acid |
| SMILES | COc1cc(N)c(N)cc1OCCCCS(=O)(=O)O |
| InChI | InChI=1S/C11H18N2O5S/c1-17-10-6-8(12)9(13)7-11(10)18-4-2-3-5-19(14,15)16/h6-7H,2-5,12-13H2,1H3,(H,14,15,16) |
| InChIKey | NVZVLWCSTOPGPK-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|