C18H28N4O8S2 — CID 158743620
4-(2,4-diaminophenoxy)butane-1-sulfonic acid;2-(2,5-diaminophenoxy)ethanesulfonic acid (PubChem CID 158743620) has the molecular formula C18H28N4O8S2 and a molecular weight of 492.58 g/mol. Its IUPAC name is 4-(2,4-diaminophenoxy)butane-1-sulfonic acid;2-(2,5-diaminophenoxy)ethanesulfonic acid.
| Compound Name | 4-(2,4-diaminophenoxy)butane-1-sulfonic acid;2-(2,5-diaminophenoxy)ethanesulfonic acid |
|---|---|
| PubChem CID | 158743620 |
| Molecular Formula | C18H28N4O8S2 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | 4-(2,4-diaminophenoxy)butane-1-sulfonic acid;2-(2,5-diaminophenoxy)ethanesulfonic acid |
| SMILES | Nc1ccc(N)c(OCCS(=O)(=O)O)c1.Nc1ccc(OCCCCS(=O)(=O)O)c(N)c1 |
| InChI | InChI=1S/C10H16N2O4S.C8H12N2O4S/c11-8-3-4-10(9(12)7-8)16-5-1-2-6-17(13,14)15;9-6-1-2-7(10)8(5-6)14-3-4-15(11,12)13/h3-4,7H,1-2,5-6,11-12H2,(H,13,14,15);1-2,5H,3-4,9-10H2,(H,11,12,13) |
| InChIKey | IMPNXOLNVXCWCV-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 231.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|