C30H40N8O4 — CID 159131226
4-[3-(2,4-diaminophenoxy)propoxy]benzene-1,3-diamine (PubChem CID 159131226) has the molecular formula C30H40N8O4 and a molecular weight of 576.70 g/mol. Its IUPAC name is 4-[3-(2,4-diaminophenoxy)propoxy]benzene-1,3-diamine.
| Compound Name | 4-[3-(2,4-diaminophenoxy)propoxy]benzene-1,3-diamine |
|---|---|
| PubChem CID | 159131226 |
| Molecular Formula | C30H40N8O4 |
| Molecular Weight | 576.70 g/mol |
| Exact Mass | 576.32 |
| IUPAC Name | 4-[3-(2,4-diaminophenoxy)propoxy]benzene-1,3-diamine |
| SMILES | Nc1ccc(OCCCOc2ccc(N)cc2N)c(N)c1.Nc1ccc(OCCCOc2ccc(N)cc2N)c(N)c1 |
| InChI | InChI=1S/2C15H20N4O2/c2*16-10-2-4-14(12(18)8-10)20-6-1-7-21-15-5-3-11(17)9-13(15)19/h2*2-5,8-9H,1,6-7,16-19H2 |
| InChIKey | KGXOMSQCGIURID-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 245.08 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.70 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|