C21H30N6O2+2 — CID 173277249
4-[3-[1-[3-(2,4-diaminophenoxy)propyl]imidazole-1,3-diium-1-yl]propoxy]benzene-1,3-diamine (PubChem CID 173277249) has the molecular formula C21H30N6O2+2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 4-[3-[1-[3-(2,4-diaminophenoxy)propyl]imidazole-1,3-diium-1-yl]propoxy]benzene-1,3-diamine.
| Compound Name | 4-[3-[1-[3-(2,4-diaminophenoxy)propyl]imidazole-1,3-diium-1-yl]propoxy]benzene-1,3-diamine |
|---|---|
| PubChem CID | 173277249 |
| Molecular Formula | C21H30N6O2+2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | 4-[3-[1-[3-(2,4-diaminophenoxy)propyl]imidazole-1,3-diium-1-yl]propoxy]benzene-1,3-diamine |
| SMILES | Nc1ccc(OCCC[N+]2(CCCOc3ccc(N)cc3N)C=C[NH+]=C2)c(N)c1 |
| InChI | InChI=1S/C21H29N6O2/c22-16-3-5-20(18(24)13-16)28-11-1-8-27(10-7-26-15-27)9-2-12-29-21-6-4-17(23)14-19(21)25/h3-7,10,13-15H,1-2,8-9,11-12,22-25H2/q+1/p+1 |
| InChIKey | JXGKHVVGQALWIN-UHFFFAOYSA-O |
| XLogP | 0.66 |
| TPSA | 136.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|