C15H24Cl4N4O3 — CID 20510277
2,3-bis(2,4-diaminophenoxy)propan-1-ol;tetrahydrochloride (PubChem CID 20510277) has the molecular formula C15H24Cl4N4O3 and a molecular weight of 450.19 g/mol. Its IUPAC name is 2,3-bis(2,4-diaminophenoxy)propan-1-ol;tetrahydrochloride.
| Compound Name | 2,3-bis(2,4-diaminophenoxy)propan-1-ol;tetrahydrochloride |
|---|---|
| PubChem CID | 20510277 |
| Molecular Formula | C15H24Cl4N4O3 |
| Molecular Weight | 450.19 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | 2,3-bis(2,4-diaminophenoxy)propan-1-ol;tetrahydrochloride |
| SMILES | Cl.Cl.Cl.Cl.Nc1ccc(OCC(CO)Oc2ccc(N)cc2N)c(N)c1 |
| InChI | InChI=1S/C15H20N4O3.4ClH/c16-9-1-3-14(12(18)5-9)21-8-11(7-20)22-15-4-2-10(17)6-13(15)19;;;;/h1-6,11,20H,7-8,16-19H2;4*1H |
| InChIKey | DRHXDAKGNOUNPH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 142.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.19 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|