C9H15N3O2 — CID 19835524
1-amino-3-(2,4-diaminophenoxy)propan-2-ol (PubChem CID 19835524) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 1-amino-3-(2,4-diaminophenoxy)propan-2-ol.
| Compound Name | 1-amino-3-(2,4-diaminophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 19835524 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 1-amino-3-(2,4-diaminophenoxy)propan-2-ol |
| SMILES | NCC(O)COc1ccc(N)cc1N |
| InChI | InChI=1S/C9H15N3O2/c10-4-7(13)5-14-9-2-1-6(11)3-8(9)12/h1-3,7,13H,4-5,10-12H2 |
| InChIKey | VQXZYUCCGJMHTP-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 107.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|