C8H17Cl2N3O2 — CID 175517081
azane;2-(2,4-diaminophenoxy)ethanol;dihydrochloride (PubChem CID 175517081) has the molecular formula C8H17Cl2N3O2 and a molecular weight of 258.15 g/mol. Its IUPAC name is azane;2-(2,4-diaminophenoxy)ethanol;dihydrochloride.
| Compound Name | azane;2-(2,4-diaminophenoxy)ethanol;dihydrochloride |
|---|---|
| PubChem CID | 175517081 |
| Molecular Formula | C8H17Cl2N3O2 |
| Molecular Weight | 258.15 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | azane;2-(2,4-diaminophenoxy)ethanol;dihydrochloride |
| SMILES | Cl.Cl.N.Nc1ccc(OCCO)c(N)c1 |
| InChI | InChI=1S/C8H12N2O2.2ClH.H3N/c9-6-1-2-8(7(10)5-6)12-4-3-11;;;/h1-2,5,11H,3-4,9-10H2;2*1H;1H3 |
| InChIKey | ULFXDKHFYAIORA-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 116.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.15 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|