C11H18N2O4 — CID 143578451
3-[2,5-diamino-4-(2-hydroxyethoxy)phenoxy]propan-1-ol (PubChem CID 143578451) has the molecular formula C11H18N2O4 and a molecular weight of 242.27 g/mol. Its IUPAC name is 3-[2,5-diamino-4-(2-hydroxyethoxy)phenoxy]propan-1-ol.
| Compound Name | 3-[2,5-diamino-4-(2-hydroxyethoxy)phenoxy]propan-1-ol |
|---|---|
| PubChem CID | 143578451 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 3-[2,5-diamino-4-(2-hydroxyethoxy)phenoxy]propan-1-ol |
| SMILES | Nc1cc(OCCCO)c(N)cc1OCCO |
| InChI | InChI=1S/C11H18N2O4/c12-8-7-11(17-5-3-15)9(13)6-10(8)16-4-1-2-14/h6-7,14-15H,1-5,12-13H2 |
| InChIKey | OBWNTOXEXISWHH-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|