C10H16N2O4 — CID 70190975
2-[3,4-diamino-5-(2-hydroxyethoxy)phenoxy]ethanol (PubChem CID 70190975) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is 2-[3,4-diamino-5-(2-hydroxyethoxy)phenoxy]ethanol.
| Compound Name | 2-[3,4-diamino-5-(2-hydroxyethoxy)phenoxy]ethanol |
|---|---|
| PubChem CID | 70190975 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 2-[3,4-diamino-5-(2-hydroxyethoxy)phenoxy]ethanol |
| SMILES | Nc1cc(OCCO)cc(OCCO)c1N |
| InChI | InChI=1S/C10H16N2O4/c11-8-5-7(15-3-1-13)6-9(10(8)12)16-4-2-14/h5-6,13-14H,1-4,11-12H2 |
| InChIKey | KULPEKKSDLBAJX-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|