About 2-(3,5-dibromophenoxy)ethanol
2-(3,5-dibromophenoxy)ethanol (PubChem CID 125479638) has the molecular formula C8H8Br2O2
and a molecular weight of 295.96 g/mol. Its IUPAC name is 2-(3,5-dibromophenoxy)ethanol.
Molecular Properties
| Compound Name | 2-(3,5-dibromophenoxy)ethanol |
| PubChem CID | 125479638 |
| Molecular Formula | C8H8Br2O2 |
| Molecular Weight | 295.96 g/mol |
| Exact Mass | 293.89 |
| IUPAC Name | 2-(3,5-dibromophenoxy)ethanol |
| SMILES | OCCOc1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C8H8Br2O2/c9-6-3-7(10)5-8(4-6)12-2-1-11/h3-5,11H,1-2H2 |
| InChIKey | NBAWYTBEJIBGFY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.96 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3,5-dibromophenoxy)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dibromophenoxy)ethanol?
The IUPAC name of 2-(3,5-dibromophenoxy)ethanol (CID 125479638) is 2-(3,5-dibromophenoxy)ethanol.
What is the SMILES notation for 2-(3,5-dibromophenoxy)ethanol?
The canonical SMILES for 2-(3,5-dibromophenoxy)ethanol is OCCOc1cc(Br)cc(Br)c1.
What is the InChIKey of 2-(3,5-dibromophenoxy)ethanol?
The InChIKey is NBAWYTBEJIBGFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Br2O2/c9-6-3-7(10)5-8(4-6)12-2-1-11/h3-5,11H,1-2H2.
What are the key properties of 2-(3,5-dibromophenoxy)ethanol?
2-(3,5-dibromophenoxy)ethanol has a molecular weight of 295.96 g/mol, XLogP of 2.58, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dibromophenoxy)ethanol is sourced from PubChem (CID 125479638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).