C10H13Br2NO — CID 58473620
4-(3,5-dibromophenoxy)butan-1-amine (PubChem CID 58473620) has the molecular formula C10H13Br2NO and a molecular weight of 323.03 g/mol. Its IUPAC name is 4-(3,5-dibromophenoxy)butan-1-amine.
| Compound Name | 4-(3,5-dibromophenoxy)butan-1-amine |
|---|---|
| PubChem CID | 58473620 |
| Molecular Formula | C10H13Br2NO |
| Molecular Weight | 323.03 g/mol |
| Exact Mass | 320.94 |
| IUPAC Name | 4-(3,5-dibromophenoxy)butan-1-amine |
| SMILES | NCCCCOc1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C10H13Br2NO/c11-8-5-9(12)7-10(6-8)14-4-2-1-3-13/h5-7H,1-4,13H2 |
| InChIKey | ZNWVTLOVHOEYBJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.03 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|