C11H14Br2O4 — CID 170993629
2-[3,5-dibromo-4-(dimethoxymethyl)phenoxy]ethanol (PubChem CID 170993629) has the molecular formula C11H14Br2O4 and a molecular weight of 370.04 g/mol. Its IUPAC name is 2-[3,5-dibromo-4-(dimethoxymethyl)phenoxy]ethanol.
| Compound Name | 2-[3,5-dibromo-4-(dimethoxymethyl)phenoxy]ethanol |
|---|---|
| PubChem CID | 170993629 |
| Molecular Formula | C11H14Br2O4 |
| Molecular Weight | 370.04 g/mol |
| Exact Mass | 367.93 |
| IUPAC Name | 2-[3,5-dibromo-4-(dimethoxymethyl)phenoxy]ethanol |
| SMILES | COC(OC)c1c(Br)cc(OCCO)cc1Br |
| InChI | InChI=1S/C11H14Br2O4/c1-15-11(16-2)10-8(12)5-7(6-9(10)13)17-4-3-14/h5-6,11,14H,3-4H2,1-2H3 |
| InChIKey | FVVGUKBSKMHHGW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.04 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|