C14H8Br6O2 — CID 57181302
1,2,3-tribromo-5-[2-(3,4,5-tribromophenoxy)ethoxy]benzene (PubChem CID 57181302) has the molecular formula C14H8Br6O2 and a molecular weight of 687.64 g/mol. Its IUPAC name is 1,2,3-tribromo-5-[2-(3,4,5-tribromophenoxy)ethoxy]benzene.
| Compound Name | 1,2,3-tribromo-5-[2-(3,4,5-tribromophenoxy)ethoxy]benzene |
|---|---|
| PubChem CID | 57181302 |
| Molecular Formula | C14H8Br6O2 |
| Molecular Weight | 687.64 g/mol |
| Exact Mass | 681.56 |
| IUPAC Name | 1,2,3-tribromo-5-[2-(3,4,5-tribromophenoxy)ethoxy]benzene |
| SMILES | Brc1cc(OCCOc2cc(Br)c(Br)c(Br)c2)cc(Br)c1Br |
| InChI | InChI=1S/C14H8Br6O2/c15-9-3-7(4-10(16)13(9)19)21-1-2-22-8-5-11(17)14(20)12(18)6-8/h3-6H,1-2H2 |
| InChIKey | WUUXWZGYDPDPGF-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.64 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|