C14H6Br8O2 — CID 21328998
1,2,3,4-tetrabromo-5-[2-(2,3,4,5-tetrabromophenoxy)ethoxy]benzene (PubChem CID 21328998) has the molecular formula C14H6Br8O2 and a molecular weight of 845.43 g/mol. Its IUPAC name is 1,2,3,4-tetrabromo-5-[2-(2,3,4,5-tetrabromophenoxy)ethoxy]benzene.
| Compound Name | 1,2,3,4-tetrabromo-5-[2-(2,3,4,5-tetrabromophenoxy)ethoxy]benzene |
|---|---|
| PubChem CID | 21328998 |
| Molecular Formula | C14H6Br8O2 |
| Molecular Weight | 845.43 g/mol |
| Exact Mass | 837.38 |
| IUPAC Name | 1,2,3,4-tetrabromo-5-[2-(2,3,4,5-tetrabromophenoxy)ethoxy]benzene |
| SMILES | Brc1cc(OCCOc2cc(Br)c(Br)c(Br)c2Br)c(Br)c(Br)c1Br |
| InChI | InChI=1S/C14H6Br8O2/c15-5-3-7(11(19)13(21)9(5)17)23-1-2-24-8-4-6(16)10(18)14(22)12(8)20/h3-4H,1-2H2 |
| InChIKey | GREIQDRDIWRYAZ-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.43 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|